C18H19ClFN3O2 — CID 120671424
2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1-(2,5-dimethoxyphenyl)guanidine (PubChem CID 120671424) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1-(2,5-dimethoxyphenyl)guanidine.
| Compound Name | 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1-(2,5-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 120671424 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1-(2,5-dimethoxyphenyl)guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/[C@@H]2C[C@H]2c2ccc(Cl)c(F)c2)c1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-24-11-4-6-17(25-2)16(8-11)23-18(21)22-15-9-12(15)10-3-5-13(19)14(20)7-10/h3-8,12,15H,9H2,1-2H3,(H3,21,22,23)/t12-,15+/m0/s1 |
| InChIKey | YSVWRQFBWZJFFP-SWLSCSKDSA-N |
| XLogP | 3.78 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|