C14H19ClFN3 — CID 122082498
2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1,1-diethylguanidine (PubChem CID 122082498) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1,1-diethylguanidine.
| Compound Name | 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 122082498 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/[C@@H]1C[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H19ClFN3/c1-3-19(4-2)14(17)18-13-8-10(13)9-5-6-11(15)12(16)7-9/h5-7,10,13H,3-4,8H2,1-2H3,(H2,17,18)/t10-,13+/m0/s1 |
| InChIKey | ZPDIXFYRDVVUAM-GXFFZTMASA-N |
| XLogP | 2.99 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|