C20H22ClFN2O3S — CID 139011561
N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-3-(diethylsulfamoyl)benzamide (PubChem CID 139011561) has the molecular formula C20H22ClFN2O3S and a molecular weight of 424.93 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 139011561 |
| Molecular Formula | C20H22ClFN2O3S |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)N[C@@H]2C[C@H]2c2ccc(Cl)c(F)c2)c1 |
| InChI | InChI=1S/C20H22ClFN2O3S/c1-3-24(4-2)28(26,27)15-7-5-6-14(10-15)20(25)23-19-12-16(19)13-8-9-17(21)18(22)11-13/h5-11,16,19H,3-4,12H2,1-2H3,(H,23,25)/t16-,19+/m0/s1 |
| InChIKey | ITQRBIXRDVWWHV-QFBILLFUSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |