C23H21FN2O3S — CID 139010906
N-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 139010906) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 139010906 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)N[C@@H]2C[C@H]2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H21FN2O3S/c1-26(19-7-3-2-4-8-19)30(28,29)20-9-5-6-17(14-20)23(27)25-22-15-21(22)16-10-12-18(24)13-11-16/h2-14,21-22H,15H2,1H3,(H,25,27)/t21-,22+/m0/s1 |
| InChIKey | LQHXEWYZWRTBCO-FCHUYYIVSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |