C26H26FN3O4S — CID 55699978
N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 55699978) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55699978 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NC2CCN(C(=O)c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C26H26FN3O4S/c1-29(21-9-3-2-4-10-21)35(33,34)22-11-7-8-19(18-22)25(31)28-20-14-16-30(17-15-20)26(32)23-12-5-6-13-24(23)27/h2-13,18,20H,14-17H2,1H3,(H,28,31) |
| InChIKey | GLOYARNBPSXTEI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |