C15H17ClFNO4 — CID 139021689
ethyl 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-3-oxopropanoate (PubChem CID 139021689) has the molecular formula C15H17ClFNO4 and a molecular weight of 329.76 g/mol. Its IUPAC name is ethyl 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 139021689 |
| Molecular Formula | C15H17ClFNO4 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | ethyl 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H17ClFNO4/c1-2-21-14(20)8-13(19)18-12-5-6-22-15(12)9-3-4-10(16)11(17)7-9/h3-4,7,12,15H,2,5-6,8H2,1H3,(H,18,19)/t12-,15+/m1/s1 |
| InChIKey | YVIXBIRQVINXKM-DOMZBBRYSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|