C18H18ClFN2O2 — CID 97109107
N-[(2R,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]-3-pyridin-4-ylpropanamide (PubChem CID 97109107) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is N-[(2R,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]-3-pyridin-4-ylpropanamide.
| Compound Name | N-[(2R,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 97109107 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[(2R,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]-3-pyridin-4-ylpropanamide |
| SMILES | O=C(CCc1ccncc1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C18H18ClFN2O2/c19-14-3-2-13(11-15(14)20)18-16(7-10-24-18)22-17(23)4-1-12-5-8-21-9-6-12/h2-3,5-6,8-9,11,16,18H,1,4,7,10H2,(H,22,23)/t16-,18-/m1/s1 |
| InChIKey | PFMCVSHPYUWXCK-SJLPKXTDSA-N |
| XLogP | 3.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |