C19H17ClFNO4 — CID 120552150
3-[2-[[2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-2-oxoethyl]benzoic acid (PubChem CID 120552150) has the molecular formula C19H17ClFNO4 and a molecular weight of 377.80 g/mol. Its IUPAC name is 3-[2-[[2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 3-[2-[[2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 120552150 |
| Molecular Formula | C19H17ClFNO4 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[2-[[2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-2-oxoethyl]benzoic acid |
| SMILES | O=C(Cc1cccc(C(=O)O)c1)NC1CCOC1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H17ClFNO4/c20-14-5-4-12(10-15(14)21)18-16(6-7-26-18)22-17(23)9-11-2-1-3-13(8-11)19(24)25/h1-5,8,10,16,18H,6-7,9H2,(H,22,23)(H,24,25) |
| InChIKey | MBDOBSOYJWWFPH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |