C18H20Cl2IN3O — CID 120671359
2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1-[2-(methoxymethyl)phenyl]guanidine;hydroiodide (PubChem CID 120671359) has the molecular formula C18H20Cl2IN3O and a molecular weight of 492.19 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1-[2-(methoxymethyl)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1-[2-(methoxymethyl)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671359 |
| Molecular Formula | C18H20Cl2IN3O |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1-[2-(methoxymethyl)phenyl]guanidine;hydroiodide |
| SMILES | COCc1ccccc1N/C(N)=N/[C@@H]1C[C@H]1c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H19Cl2N3O.HI/c1-24-10-12-4-2-3-5-16(12)22-18(21)23-17-9-13(17)11-6-7-14(19)15(20)8-11;/h2-8,13,17H,9-10H2,1H3,(H3,21,22,23);1H/t13-,17+;/m0./s1 |
| InChIKey | ZCTRICAYCKRUIV-OZIFAFRSSA-N |
| XLogP | 5.04 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|