C12H16F2IN3 — CID 119147957
2-[2-(2,6-difluorophenyl)cyclopropyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 119147957) has the molecular formula C12H16F2IN3 and a molecular weight of 367.18 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)cyclopropyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,6-difluorophenyl)cyclopropyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119147957 |
| Molecular Formula | C12H16F2IN3 |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)cyclopropyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(N)=N/C1CC1c1c(F)cccc1F.I |
| InChI | InChI=1S/C12H15F2N3.HI/c1-17(2)12(15)16-10-6-7(10)11-8(13)4-3-5-9(11)14;/h3-5,7,10H,6H2,1-2H3,(H2,15,16);1H |
| InChIKey | GGOOZGBHBZARCH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|