C14H18FN3 — CID 122098698
1-cyclopropyl-2-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-1-methylguanidine (PubChem CID 122098698) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-1-methylguanidine |
|---|---|
| PubChem CID | 122098698 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-cyclopropyl-2-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-1-methylguanidine |
| SMILES | CN(/C(N)=N/[C@@H]1C[C@H]1c1ccccc1F)C1CC1 |
| InChI | InChI=1S/C14H18FN3/c1-18(9-6-7-9)14(16)17-13-8-11(13)10-4-2-3-5-12(10)15/h2-5,9,11,13H,6-8H2,1H3,(H2,16,17)/t11-,13+/m0/s1 |
| InChIKey | KASASRGQAXPNSV-WCQYABFASA-N |
| XLogP | 2.09 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|