C18H21N3S — CID 120666030
N'-[(1R,2S)-2-naphthalen-1-ylcyclopropyl]thiomorpholine-4-carboximidamide (PubChem CID 120666030) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N'-[(1R,2S)-2-naphthalen-1-ylcyclopropyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(1R,2S)-2-naphthalen-1-ylcyclopropyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120666030 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N'-[(1R,2S)-2-naphthalen-1-ylcyclopropyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\[C@@H]1C[C@H]1c1cccc2ccccc12)N1CCSCC1 |
| InChI | InChI=1S/C18H21N3S/c19-18(21-8-10-22-11-9-21)20-17-12-16(17)15-7-3-5-13-4-1-2-6-14(13)15/h1-7,16-17H,8-12H2,(H2,19,20)/t16-,17+/m0/s1 |
| InChIKey | IKPIWWBAQOAHAC-DLBZAZTESA-N |
| XLogP | 3.06 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|