C16H22FN3 — CID 120606046
N'-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]azepane-1-carboximidamide (PubChem CID 120606046) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is N'-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]azepane-1-carboximidamide.
| Compound Name | N'-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 120606046 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | N'-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]azepane-1-carboximidamide |
| SMILES | N/C(=N\[C@@H]1C[C@H]1c1cccc(F)c1)N1CCCCCC1 |
| InChI | InChI=1S/C16H22FN3/c17-13-7-5-6-12(10-13)14-11-15(14)19-16(18)20-8-3-1-2-4-9-20/h5-7,10,14-15H,1-4,8-9,11H2,(H2,18,19)/t14-,15+/m0/s1 |
| InChIKey | AUKNXKZLTYFNKU-LSDHHAIUSA-N |
| XLogP | 2.87 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|