C16H23FIN3OS — CID 120762820
N'-[3-(3-fluoro-4-methoxyphenyl)cyclobutyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120762820) has the molecular formula C16H23FIN3OS and a molecular weight of 451.35 g/mol. Its IUPAC name is N'-[3-(3-fluoro-4-methoxyphenyl)cyclobutyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(3-fluoro-4-methoxyphenyl)cyclobutyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120762820 |
| Molecular Formula | C16H23FIN3OS |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N'-[3-(3-fluoro-4-methoxyphenyl)cyclobutyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | COc1ccc(C2CC(/N=C(\N)N3CCSCC3)C2)cc1F.I |
| InChI | InChI=1S/C16H22FN3OS.HI/c1-21-15-3-2-11(10-14(15)17)12-8-13(9-12)19-16(18)20-4-6-22-7-5-20;/h2-3,10,12-13H,4-9H2,1H3,(H2,18,19);1H |
| InChIKey | TYWJZVFTJPOOMD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|