C16H21F3IN3O — CID 120671720
N'-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120671720) has the molecular formula C16H21F3IN3O and a molecular weight of 455.26 g/mol. Its IUPAC name is N'-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120671720 |
| Molecular Formula | C16H21F3IN3O |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N'-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\C1CC(c2cccc(C(F)(F)F)c2)C1)N1CCOCC1 |
| InChI | InChI=1S/C16H20F3N3O.HI/c17-16(18,19)13-3-1-2-11(8-13)12-9-14(10-12)21-15(20)22-4-6-23-7-5-22;/h1-3,8,12,14H,4-7,9-10H2,(H2,20,21);1H |
| InChIKey | OZJNPJJUKNTMCL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|