C15H19Cl2N3O — CID 120679856
N'-[3-(3,4-dichlorophenyl)cyclobutyl]morpholine-4-carboximidamide (PubChem CID 120679856) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is N'-[3-(3,4-dichlorophenyl)cyclobutyl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-(3,4-dichlorophenyl)cyclobutyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120679856 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N'-[3-(3,4-dichlorophenyl)cyclobutyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\C1CC(c2ccc(Cl)c(Cl)c2)C1)N1CCOCC1 |
| InChI | InChI=1S/C15H19Cl2N3O/c16-13-2-1-10(9-14(13)17)11-7-12(8-11)19-15(18)20-3-5-21-6-4-20/h1-2,9,11-12H,3-8H2,(H2,18,19) |
| InChIKey | DPTKQXYLJBVNIN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|