C13H16Cl2N2O3 — CID 66980869
aminomethyl 6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate (PubChem CID 66980869) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is aminomethyl 6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | aminomethyl 6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66980869 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | aminomethyl 6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate |
| SMILES | NCOC(=O)N1CCOCC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16Cl2N2O3/c14-11-2-1-9(5-12(11)15)10-6-17(3-4-19-7-10)13(18)20-8-16/h1-2,5,10H,3-4,6-8,16H2 |
| InChIKey | GDAXJDNDZAWZFA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|