C25H28F3N3O3 — CID 118422568
N-[1-(2-morpholin-4-yl-2-oxoethyl)-5-[3-(trifluoromethyl)phenyl]piperidin-3-yl]benzamide (PubChem CID 118422568) has the molecular formula C25H28F3N3O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[1-(2-morpholin-4-yl-2-oxoethyl)-5-[3-(trifluoromethyl)phenyl]piperidin-3-yl]benzamide.
| Compound Name | N-[1-(2-morpholin-4-yl-2-oxoethyl)-5-[3-(trifluoromethyl)phenyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 118422568 |
| Molecular Formula | C25H28F3N3O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[1-(2-morpholin-4-yl-2-oxoethyl)-5-[3-(trifluoromethyl)phenyl]piperidin-3-yl]benzamide |
| SMILES | O=C(NC1CC(c2cccc(C(F)(F)F)c2)CN(CC(=O)N2CCOCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H28F3N3O3/c26-25(27,28)21-8-4-7-19(13-21)20-14-22(29-24(33)18-5-2-1-3-6-18)16-30(15-20)17-23(32)31-9-11-34-12-10-31/h1-8,13,20,22H,9-12,14-17H2,(H,29,33) |
| InChIKey | ABXMHTKIMCVNFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |