C21H23F3N2O3 — CID 178166229
1-(2-ethoxyethyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]pyridine-3-carboxamide (PubChem CID 178166229) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]pyridine-3-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178166229 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-(2-ethoxyethyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]cyclobutyl]pyridine-3-carboxamide |
| SMILES | CCOCCn1cc(C(=O)NC2CC(c3cccc(C(F)(F)F)c3)C2)ccc1=O |
| InChI | InChI=1S/C21H23F3N2O3/c1-2-29-9-8-26-13-15(6-7-19(26)27)20(28)25-18-11-16(12-18)14-4-3-5-17(10-14)21(22,23)24/h3-7,10,13,16,18H,2,8-9,11-12H2,1H3,(H,25,28) |
| InChIKey | FMRSQZVLDBPKSI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|