C16H19F3N2O3 — CID 122013012
4-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]butanoic acid (PubChem CID 122013012) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 4-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122013012 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NC1CC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H19F3N2O3/c17-16(18,19)12-4-1-3-10(7-12)11-8-13(9-11)21-15(24)20-6-2-5-14(22)23/h1,3-4,7,11,13H,2,5-6,8-9H2,(H,22,23)(H2,20,21,24) |
| InChIKey | GFSOEMLBGOQHNO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|