C15H17F3N2O3 — CID 122013011
3-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]propanoic acid (PubChem CID 122013011) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 3-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122013011 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[[3-[3-(trifluoromethyl)phenyl]cyclobutyl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NC1CC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H17F3N2O3/c16-15(17,18)11-3-1-2-9(6-11)10-7-12(8-10)20-14(23)19-5-4-13(21)22/h1-3,6,10,12H,4-5,7-8H2,(H,21,22)(H2,19,20,23) |
| InChIKey | SXXDIURFRULPQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |