C19H21FN2O3 — CID 178166143
1-(2-ethoxyethyl)-5-fluoro-6-oxo-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide (PubChem CID 178166143) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-fluoro-6-oxo-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-5-fluoro-6-oxo-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178166143 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-fluoro-6-oxo-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide |
| SMILES | CCOCCn1cc(C(=O)N[C@@H]2C[C@H]2c2ccccc2)cc(F)c1=O |
| InChI | InChI=1S/C19H21FN2O3/c1-2-25-9-8-22-12-14(10-16(20)19(22)24)18(23)21-17-11-15(17)13-6-4-3-5-7-13/h3-7,10,12,15,17H,2,8-9,11H2,1H3,(H,21,23)/t15-,17+/m0/s1 |
| InChIKey | OWUDRPZEDOFZQZ-DOTOQJQBSA-N |
| XLogP | 2.31 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|