C17H16FNO — CID 62513017
2-fluoro-5-methyl-N-(2-phenylcyclopropyl)benzamide (PubChem CID 62513017) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(2-phenylcyclopropyl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(2-phenylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 62513017 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-fluoro-5-methyl-N-(2-phenylcyclopropyl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC2CC2c2ccccc2)c1 |
| InChI | InChI=1S/C17H16FNO/c1-11-7-8-15(18)14(9-11)17(20)19-16-10-13(16)12-5-3-2-4-6-12/h2-9,13,16H,10H2,1H3,(H,19,20) |
| InChIKey | QFKRCJKTKURULH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |