C14H14N2OS — CID 134108990
3-methyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,2-thiazole-4-carboxamide (PubChem CID 134108990) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 3-methyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-methyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 134108990 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-methyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1nscc1C(=O)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H14N2OS/c1-9-12(8-18-16-9)14(17)15-13-7-11(13)10-5-3-2-4-6-10/h2-6,8,11,13H,7H2,1H3,(H,15,17)/t11-,13+/m1/s1 |
| InChIKey | AEVQJGOZDFAYNT-YPMHNXCESA-N |
| XLogP | 2.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |