C16H16N2O — CID 73011269
6-methyl-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide (PubChem CID 73011269) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 6-methyl-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 73011269 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 6-methyl-N-[(1R,2S)-2-phenylcyclopropyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2C[C@H]2c2ccccc2)cn1 |
| InChI | InChI=1S/C16H16N2O/c1-11-7-8-13(10-17-11)16(19)18-15-9-14(15)12-5-3-2-4-6-12/h2-8,10,14-15H,9H2,1H3,(H,18,19)/t14-,15+/m0/s1 |
| InChIKey | SUCDADQDPNNWAN-LSDHHAIUSA-N |
| XLogP | 2.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |