C22H25F3N2O2 — CID 16892603
N-[4-(2-phenylmorpholin-4-yl)butyl]-3-(trifluoromethyl)benzamide (PubChem CID 16892603) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[4-(2-phenylmorpholin-4-yl)butyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-phenylmorpholin-4-yl)butyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16892603 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[4-(2-phenylmorpholin-4-yl)butyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCN1CCOC(c2ccccc2)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F3N2O2/c23-22(24,25)19-10-6-9-18(15-19)21(28)26-11-4-5-12-27-13-14-29-20(16-27)17-7-2-1-3-8-17/h1-3,6-10,15,20H,4-5,11-14,16H2,(H,26,28) |
| InChIKey | ORDJVGDPEFTRAQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|