C22H27N3O4 — CID 16892657
4-methyl-3-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide (PubChem CID 16892657) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
|---|---|
| PubChem CID | 16892657 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-methyl-3-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCCCN2CCOC(c3ccccc3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H27N3O4/c1-17-9-10-19(15-20(17)25(27)28)22(26)23-11-5-6-12-24-13-14-29-21(16-24)18-7-3-2-4-8-18/h2-4,7-10,15,21H,5-6,11-14,16H2,1H3,(H,23,26) |
| InChIKey | UKUDYYIKYSESTL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|