C21H24ClN3O4 — CID 16892605
2-chloro-5-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide (PubChem CID 16892605) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide.
| Compound Name | 2-chloro-5-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
|---|---|
| PubChem CID | 16892605 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-chloro-5-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
| SMILES | O=C(NCCCCN1CCOC(c2ccccc2)C1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H24ClN3O4/c22-19-9-8-17(25(27)28)14-18(19)21(26)23-10-4-5-11-24-12-13-29-20(15-24)16-6-2-1-3-7-16/h1-3,6-9,14,20H,4-5,10-13,15H2,(H,23,26) |
| InChIKey | RYHJORYDXWMCRX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|