C23H29N3O6 — CID 16892622
4,5-dimethoxy-2-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide (PubChem CID 16892622) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide.
| Compound Name | 4,5-dimethoxy-2-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
|---|---|
| PubChem CID | 16892622 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-[4-(2-phenylmorpholin-4-yl)butyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCN2CCOC(c3ccccc3)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H29N3O6/c1-30-20-14-18(19(26(28)29)15-21(20)31-2)23(27)24-10-6-7-11-25-12-13-32-22(16-25)17-8-4-3-5-9-17/h3-5,8-9,14-15,22H,6-7,10-13,16H2,1-2H3,(H,24,27) |
| InChIKey | RGMXSCSIHBZCMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|