C20H22BrClN2O2 — CID 16892507
5-bromo-2-chloro-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide (PubChem CID 16892507) has the molecular formula C20H22BrClN2O2 and a molecular weight of 437.77 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 16892507 |
| Molecular Formula | C20H22BrClN2O2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 5-bromo-2-chloro-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1CCOC(c2ccccc2)C1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C20H22BrClN2O2/c21-16-7-8-18(22)17(13-16)20(25)23-9-4-10-24-11-12-26-19(14-24)15-5-2-1-3-6-15/h1-3,5-8,13,19H,4,9-12,14H2,(H,23,25) |
| InChIKey | MGSXYPKVUUTMEN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|