C21H26N2O2 — CID 16892568
3-methyl-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide (PubChem CID 16892568) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide.
| Compound Name | 3-methyl-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 16892568 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-methyl-N-[3-(2-phenylmorpholin-4-yl)propyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCCN2CCOC(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-17-7-5-10-19(15-17)21(24)22-11-6-12-23-13-14-25-20(16-23)18-8-3-2-4-9-18/h2-5,7-10,15,20H,6,11-14,16H2,1H3,(H,22,24) |
| InChIKey | MRQZPSIWHOUZIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|