C14H16F3NO3 — CID 124704543
3-[(2S)-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid (PubChem CID 124704543) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 3-[(2S)-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[(2S)-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 124704543 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-[(2S)-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCO[C@@H](c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H16F3NO3/c15-14(16,17)11-3-1-2-10(8-11)12-9-18(6-7-21-12)5-4-13(19)20/h1-3,8,12H,4-7,9H2,(H,19,20)/t12-/m1/s1 |
| InChIKey | DWRQKHPRCHTOGZ-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |