C26H33N3O5 — CID 90879634
ethyl 4-[5-benzamido-1-[hydroxy(morpholin-4-yl)methyl]piperidin-3-yl]benzoate (PubChem CID 90879634) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is ethyl 4-[5-benzamido-1-[hydroxy(morpholin-4-yl)methyl]piperidin-3-yl]benzoate.
| Compound Name | ethyl 4-[5-benzamido-1-[hydroxy(morpholin-4-yl)methyl]piperidin-3-yl]benzoate |
|---|---|
| PubChem CID | 90879634 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | ethyl 4-[5-benzamido-1-[hydroxy(morpholin-4-yl)methyl]piperidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2CC(NC(=O)c3ccccc3)CN(C(O)N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C26H33N3O5/c1-2-34-25(31)21-10-8-19(9-11-21)22-16-23(27-24(30)20-6-4-3-5-7-20)18-29(17-22)26(32)28-12-14-33-15-13-28/h3-11,22-23,26,32H,2,12-18H2,1H3,(H,27,30) |
| InChIKey | YAEXBMBWFPQJFH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |