C22H25F3N4O2 — CID 110255279
1-morpholin-4-yl-2-[3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 110255279) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-morpholin-4-yl-2-[3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110255279 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-morpholin-4-yl-2-[3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC(c2cncc(-c3cccc(C(F)(F)F)c3)n2)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H25F3N4O2/c23-22(24,25)18-5-1-3-16(11-18)19-12-26-13-20(27-19)17-4-2-6-28(14-17)15-21(30)29-7-9-31-10-8-29/h1,3,5,11-13,17H,2,4,6-10,14-15H2 |
| InChIKey | NUIHJRBFQSATNE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |