C23H27F3N4O — CID 95819607
1-piperidin-1-yl-2-[4-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 95819607) has the molecular formula C23H27F3N4O and a molecular weight of 432.49 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[4-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-piperidin-1-yl-2-[4-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95819607 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-piperidin-1-yl-2-[4-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC(c2cncc(-c3cccc(C(F)(F)F)c3)n2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C23H27F3N4O/c24-23(25,26)19-6-4-5-18(13-19)21-15-27-14-20(28-21)17-7-11-29(12-8-17)16-22(31)30-9-2-1-3-10-30/h4-6,13-15,17H,1-3,7-12,16H2 |
| InChIKey | KBTBQVBFTMGXRR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |