C22H21F3N4 — CID 95819638
2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-6-[3-(trifluoromethyl)phenyl]pyrazine (PubChem CID 95819638) has the molecular formula C22H21F3N4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-6-[3-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | 2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-6-[3-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 95819638 |
| Molecular Formula | C22H21F3N4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-6-[3-(trifluoromethyl)phenyl]pyrazine |
| SMILES | FC(F)(F)c1cccc(-c2cncc(C3CCN(Cc4ccncc4)CC3)n2)c1 |
| InChI | InChI=1S/C22H21F3N4/c23-22(24,25)19-3-1-2-18(12-19)21-14-27-13-20(28-21)17-6-10-29(11-7-17)15-16-4-8-26-9-5-16/h1-5,8-9,12-14,17H,6-7,10-11,15H2 |
| InChIKey | WSLOXHONQMLZEI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |