C23H21F4N3 — CID 141285088
5-fluoro-2-[4-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]phenyl]pyrimidine (PubChem CID 141285088) has the molecular formula C23H21F4N3 and a molecular weight of 415.43 g/mol. Its IUPAC name is 5-fluoro-2-[4-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]phenyl]pyrimidine.
| Compound Name | 5-fluoro-2-[4-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 141285088 |
| Molecular Formula | C23H21F4N3 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-fluoro-2-[4-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]phenyl]pyrimidine |
| SMILES | Fc1cnc(-c2ccc(CN3CCC(c4cccc(C(F)(F)F)c4)CC3)cc2)nc1 |
| InChI | InChI=1S/C23H21F4N3/c24-21-13-28-22(29-14-21)18-6-4-16(5-7-18)15-30-10-8-17(9-11-30)19-2-1-3-20(12-19)23(25,26)27/h1-7,12-14,17H,8-11,15H2 |
| InChIKey | ANRZBIRXGJPZRO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |