C28H27F3N4O2 — CID 122584731
N-hydroxy-4-[[5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzamide (PubChem CID 122584731) has the molecular formula C28H27F3N4O2 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-hydroxy-4-[[5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122584731 |
| Molecular Formula | C28H27F3N4O2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | N-hydroxy-4-[[5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzamide |
| SMILES | O=C(NO)c1ccc(Cn2ccc3cc(C4CCN(Cc5cccc(C(F)(F)F)c5)CC4)cnc32)cc1 |
| InChI | InChI=1S/C28H27F3N4O2/c29-28(30,31)25-3-1-2-20(14-25)17-34-11-8-21(9-12-34)24-15-23-10-13-35(26(23)32-16-24)18-19-4-6-22(7-5-19)27(36)33-37/h1-7,10,13-16,21,37H,8-9,11-12,17-18H2,(H,33,36) |
| InChIKey | IFUUVMXHHGTNHB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|