C21H22N2O3 — CID 118148276
methyl 4-[[5-(oxan-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate (PubChem CID 118148276) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 4-[[5-(oxan-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[5-(oxan-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118148276 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl 4-[[5-(oxan-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2ccc3cc(C4CCOCC4)cnc32)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-25-21(24)17-4-2-15(3-5-17)14-23-9-6-18-12-19(13-22-20(18)23)16-7-10-26-11-8-16/h2-6,9,12-13,16H,7-8,10-11,14H2,1H3 |
| InChIKey | BTBTUJZYLAVIPM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |