C27H29N3O4S — CID 163519486
(S)-[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]phenyl]-methoxymethanol (PubChem CID 163519486) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is (S)-[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]phenyl]-methoxymethanol.
| Compound Name | (S)-[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]phenyl]-methoxymethanol |
|---|---|
| PubChem CID | 163519486 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (S)-[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]phenyl]-methoxymethanol |
| SMILES | CO[C@H](O)c1ccc(Cn2ccc3cc(C4CCN(S(=O)(=O)c5ccccc5)CC4)cnc32)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-34-27(31)22-9-7-20(8-10-22)19-29-14-11-23-17-24(18-28-26(23)29)21-12-15-30(16-13-21)35(32,33)25-5-3-2-4-6-25/h2-11,14,17-18,21,27,31H,12-13,15-16,19H2,1H3/t27-/m0/s1 |
| InChIKey | DJNGRUSFOQUSOZ-MHZLTWQESA-N |
| XLogP | 4.29 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|