C23H28ClN3O5S — CID 71106472
2-[5-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]ethane-1,1-diol (PubChem CID 71106472) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is 2-[5-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]ethane-1,1-diol.
| Compound Name | 2-[5-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 71106472 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[5-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]ethane-1,1-diol |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(c3cn(CC(O)O)c4ncc(Cl)cc34)CC2)cc1 |
| InChI | InChI=1S/C23H28ClN3O5S/c1-15(2)32-18-3-5-19(6-4-18)33(30,31)27-9-7-16(8-10-27)21-13-26(14-22(28)29)23-20(21)11-17(24)12-25-23/h3-6,11-13,15-16,22,28-29H,7-10,14H2,1-2H3 |
| InChIKey | XURMXMGKTJGTLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|