C20H26N2O5S — CID 171678480
formic acid;4-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyridine (PubChem CID 171678480) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is formic acid;4-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyridine.
| Compound Name | formic acid;4-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 171678480 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | formic acid;4-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyridine |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(c3ccncc3)CC2)cc1.O=CO |
| InChI | InChI=1S/C19H24N2O3S.CH2O2/c1-15(2)24-18-3-5-19(6-4-18)25(22,23)21-13-9-17(10-14-21)16-7-11-20-12-8-16;2-1-3/h3-8,11-12,15,17H,9-10,13-14H2,1-2H3;1H,(H,2,3) |
| InChIKey | YHAUFTMZLGZCMQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|