C20H32N2O5S — CID 171678492
formic acid;4-piperidin-1-yl-1-(4-propan-2-yloxyphenyl)sulfonylpiperidine (PubChem CID 171678492) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is formic acid;4-piperidin-1-yl-1-(4-propan-2-yloxyphenyl)sulfonylpiperidine.
| Compound Name | formic acid;4-piperidin-1-yl-1-(4-propan-2-yloxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 171678492 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | formic acid;4-piperidin-1-yl-1-(4-propan-2-yloxyphenyl)sulfonylpiperidine |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(N3CCCCC3)CC2)cc1.O=CO |
| InChI | InChI=1S/C19H30N2O3S.CH2O2/c1-16(2)24-18-6-8-19(9-7-18)25(22,23)21-14-10-17(11-15-21)20-12-4-3-5-13-20;2-1-3/h6-9,16-17H,3-5,10-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | ZPCGIJQLRUFUFM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|