C23H25ClN2O4S — CID 88933218
2-[7-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde (PubChem CID 88933218) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is 2-[7-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde.
| Compound Name | 2-[7-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 88933218 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[7-chloro-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(c3cn(CC=O)c4c(Cl)cccc34)C2)cc1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-16(2)30-18-6-8-19(9-7-18)31(28,29)26-11-10-17(14-26)21-15-25(12-13-27)23-20(21)4-3-5-22(23)24/h3-9,13,15-17H,10-12,14H2,1-2H3 |
| InChIKey | QGHGOZRLLVFQNV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|