C23H26BrN3O5S — CID 88975359
2-[6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxypyrrolo[2,3-b]pyridin-1-yl]acetaldehyde (PubChem CID 88975359) has the molecular formula C23H26BrN3O5S and a molecular weight of 536.45 g/mol. Its IUPAC name is 2-[6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxypyrrolo[2,3-b]pyridin-1-yl]acetaldehyde.
| Compound Name | 2-[6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxypyrrolo[2,3-b]pyridin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 88975359 |
| Molecular Formula | C23H26BrN3O5S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 2-[6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxypyrrolo[2,3-b]pyridin-1-yl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(Oc3cn(CC=O)c4nc(Br)ccc34)CC2)cc1 |
| InChI | InChI=1S/C23H26BrN3O5S/c1-16(2)31-17-3-5-19(6-4-17)33(29,30)27-11-9-18(10-12-27)32-21-15-26(13-14-28)23-20(21)7-8-22(24)25-23/h3-8,14-16,18H,9-13H2,1-2H3 |
| InChIKey | NTMBXXJMVCOOCJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|