C30H32N2O5S — CID 88933197
2-[6-(3-methoxyphenyl)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde (PubChem CID 88933197) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-[6-(3-methoxyphenyl)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde.
| Compound Name | 2-[6-(3-methoxyphenyl)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 88933197 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 2-[6-(3-methoxyphenyl)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
| SMILES | COc1cccc(-c2ccc3c(C4CCN(S(=O)(=O)c5ccc(OC(C)C)cc5)C4)cn(CC=O)c3c2)c1 |
| InChI | InChI=1S/C30H32N2O5S/c1-21(2)37-25-8-10-27(11-9-25)38(34,35)32-14-13-24(19-32)29-20-31(15-16-33)30-18-23(7-12-28(29)30)22-5-4-6-26(17-22)36-3/h4-12,16-18,20-21,24H,13-15,19H2,1-3H3 |
| InChIKey | XVIJKTQNGSIKGQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|