C28H30N2O6S — CID 88933263
2-[6-(furan-3-ylmethoxy)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde (PubChem CID 88933263) has the molecular formula C28H30N2O6S and a molecular weight of 522.62 g/mol. Its IUPAC name is 2-[6-(furan-3-ylmethoxy)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde.
| Compound Name | 2-[6-(furan-3-ylmethoxy)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 88933263 |
| Molecular Formula | C28H30N2O6S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-[6-(furan-3-ylmethoxy)-3-[1-(4-propan-2-yloxyphenyl)sulfonylpyrrolidin-3-yl]indol-1-yl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(c3cn(CC=O)c4cc(OCc5ccoc5)ccc34)C2)cc1 |
| InChI | InChI=1S/C28H30N2O6S/c1-20(2)36-23-3-6-25(7-4-23)37(32,33)30-11-9-22(16-30)27-17-29(12-13-31)28-15-24(5-8-26(27)28)35-19-21-10-14-34-18-21/h3-8,10,13-15,17-18,20,22H,9,11-12,16,19H2,1-2H3 |
| InChIKey | MKFBDKCACWIILR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|