C24H27FN2O4S — CID 88578513
2-[6-fluoro-1-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]indol-3-yl]acetaldehyde (PubChem CID 88578513) has the molecular formula C24H27FN2O4S and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[6-fluoro-1-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]indol-3-yl]acetaldehyde.
| Compound Name | 2-[6-fluoro-1-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]indol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 88578513 |
| Molecular Formula | C24H27FN2O4S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[6-fluoro-1-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]indol-3-yl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(n3cc(CC=O)c4ccc(F)cc43)CC2)cc1 |
| InChI | InChI=1S/C24H27FN2O4S/c1-17(2)31-21-4-6-22(7-5-21)32(29,30)26-12-9-20(10-13-26)27-16-18(11-14-28)23-8-3-19(25)15-24(23)27/h3-8,14-17,20H,9-13H2,1-2H3 |
| InChIKey | LVDRAPQYCOFKQZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|