C23H28FNO6S — CID 134135732
3-[5-fluoro-2-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxyphenyl]propanoic acid (PubChem CID 134135732) has the molecular formula C23H28FNO6S and a molecular weight of 465.54 g/mol. Its IUPAC name is 3-[5-fluoro-2-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxyphenyl]propanoic acid.
| Compound Name | 3-[5-fluoro-2-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 134135732 |
| Molecular Formula | C23H28FNO6S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3-[5-fluoro-2-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]oxyphenyl]propanoic acid |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(Oc3ccc(F)cc3CCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H28FNO6S/c1-16(2)30-19-5-7-21(8-6-19)32(28,29)25-13-11-20(12-14-25)31-22-9-4-18(24)15-17(22)3-10-23(26)27/h4-9,15-16,20H,3,10-14H2,1-2H3,(H,26,27) |
| InChIKey | MMXKDQMIMHHPQZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |