C19H22FNO5S — CID 110396998
1-(3,4-dimethoxyphenyl)sulfonyl-4-(4-fluorophenoxy)piperidine (PubChem CID 110396998) has the molecular formula C19H22FNO5S and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-(4-fluorophenoxy)piperidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(4-fluorophenoxy)piperidine |
|---|---|
| PubChem CID | 110396998 |
| Molecular Formula | C19H22FNO5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(4-fluorophenoxy)piperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(Oc3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C19H22FNO5S/c1-24-18-8-7-17(13-19(18)25-2)27(22,23)21-11-9-16(10-12-21)26-15-5-3-14(20)4-6-15/h3-8,13,16H,9-12H2,1-2H3 |
| InChIKey | BWUJXAUQHPRNMR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |